bornyl propionate


bornyl propionate; 1,7,7-trimethylbicyclo[2.2.1]heptan-2-yl propionate
Formula:C13H22O2; 210.32 g/mol
InChiKey:FAFMZORPAAGQFV-UHFFFAOYSA-N
SMILES:CCC(=O)OC1CC2CCC1(C)C2(C)C
Molecular structure of bornyl propionate
Dipole moment:1.84 D
Boiling point:235 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature

Isomers

bornyl propionate
Molecular structure of bornyl propionate
λ-bornyl propionate
Molecular structure of l-bornyl propionate
trans-4-tert-butylcyclohexyl prop-2-enoate
Molecular structure of trans-4-tert-butylcyclohexyl prop-2-enoate
ethyl 10-undecynoate
Molecular structure of ethyl 10-undecynoate
geranyl propionate
Molecular structure of geranyl propionate
isobornyl propionate
Molecular structure of isobornyl propionate
linalyl propionate
Molecular structure of linalyl propionate
lyral
Molecular structure of lyral